View source for Chemistry:ZM-241,385

{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 360578336
| ImageFile = ZM-241,385 Structure.svg
| ImageSize =
| PIN = 4-(2-<nowiki/>{[7-Amino-2-(furan-2-yl)[1,2,4]triazolo[1,5-''a''][1,3,5]triazin-5-yl]amino}ethyl)phenol
| OtherNames =
| Section1 = {{Chembox Identifiers 
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 139180-30-6 
| PubChem = 176407 
| IUPHAR_ligand = 405
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 5NIC36BO71
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 113142
| SMILES = Oc1ccc(CCNc2nc3nc(c4ccco4)nn3c(N)n2)cc1 
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 153646
| InChI = 1/C16H15N7O2/c17-14-20-15(18-8-7-10-3-5-11(24)6-4-10)21-16-19-13(22-23(14)16)12-2-1-9-25-12/h1-6,9,24H,7-8H2,(H3,17,18,19,20,21,22)
| InChIKey = PWTBZOIUWZOPFT-UHFFFAOYAJ
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C16H15N7O2/c17-14-20-15(18-8-7-10-3-5-11(24)6-4-10)21-16-19-13(22-23(14)16)12-2-1-9-25-12/h1-6,9,24H,7-8H2,(H3,17,18,19,20,21,22)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = PWTBZOIUWZOPFT-UHFFFAOYSA-N
  }}
| Section2 = {{Chembox Properties 
| C=16|H=15|N=7|O=2
| Appearance =  
| Density =  
| MeltingPt =  
| BoilingPt =  
| Solubility =
  }}
| Section3 = {{Chembox Hazards 
| MainHazards =  
| FlashPt =  
| AutoignitionPt = 
  }}
}}

'''ZM-241,385''' is a high affinity [[Biology:Receptor antagonist|antagonist]] [[Biology:Ligand (biochemistry)|ligand]] selective for the adenosine A<sub>2A</sub> receptor.<ref name="pmid8848012">{{cite journal | vauthors = Palmer TM, Poucher SM, Jacobson KA, Stiles GL | title = <sup>125</sup>I-4-(2-(7-amino-2-(2-furyl)(1,2,4)triazolo(2,3-a)(1,3,5) triazin-5-yl-amino)ethyl)phenol, a high affinity antagonist radioligand selective for the A2a adenosine receptor | journal = Molecular Pharmacology | volume = 48 | issue = 6 | pages = 970–4 |date=December 1995 | pmid = 8848012 | url = http://molpharm.aspetjournals.org/cgi/content/abstract/48/6/970 | pmc=3479638}}</ref>

In animal models, ZM-241,385 has been shown to protect against beta amyloid [[Chemistry:Neurotoxicity|neurotoxicity]] and therefore may be useful as a treatment for [[Medicine:Alzheimer's disease|Alzheimer's disease]].<ref name="pmid12711619">{{cite journal | vauthors = Dall'Igna OP, Porciúncula LO, Souza DO, Cunha RA, Lara DR, Dall'lgna OP | title = Neuroprotection by caffeine and adenosine A2A receptor blockade of beta-amyloid neurotoxicity | journal = British Journal of Pharmacology | volume = 138 | issue = 7 | pages = 1207–9 |date=April 2003 | pmid = 12711619 | pmc = 1573785 | doi = 10.1038/sj.bjp.0705185 }}</ref> ZM-241,385 has also been shown to enhance [[Chemistry:L-DOPA|L-DOPA]] derived [[Biology:Dopamine|dopamine]] release and therefore may be useful in the treatment of [[Medicine:Parkinson's disease|Parkinson's disease]].<ref name="pmid15275831">{{cite journal | vauthors = Gołembiowska K, Dziubina A | title = Striatal adenosine A(2A) receptor blockade increases extracellular dopamine release following l-DOPA administration in intact and dopamine-denervated rats | journal = Neuropharmacology | volume = 47 | issue = 3 | pages = 414–26 |date=September 2004 | pmid = 15275831 | doi = 10.1016/j.neuropharm.2004.04.018 }}</ref>

==References==
{{Reflist}}

==External links==
{{MeshName|ZM+241385}}

{{Adenosinergics}}

[[Category:Phenols]]
[[Category:2-Furyl compounds]]
[[Category:Adenosine receptor antagonists]]



{{Sourceattribution|ZM-241,385}}